A0791112
4-Aminophthalic acid , >95.0%(T) , 5434-21-9
CAS NO.:5434-21-9
Empirical Formula: C8H7NO4
Molecular Weight: 181.15
MDL number: MFCD00013985
EINECS: 226-596-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5G | RMB33.60 | In Stock |
|
| 25G | RMB116.00 | In Stock |
|
| 100G | RMB408.80 | In Stock |
|
| 500g | RMB1829.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 344 °C (dec.)(lit.) |
| Boiling point: | 465.1±40.0 °C(Predicted) |
| Density | 1.551±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 3.41±0.10(Predicted) |
| form | powder to crystal |
| color | White to Gray to Brown |
| BRN | 2723405 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C8H7NO4/c9-4-1-2-5(7(10)11)6(3-4)8(12)13/h1-3H,9H2,(H,10,11)(H,12,13) |
| InChIKey | OXSANYRLJHSQEP-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=CC=C(N)C=C1C(O)=O |
| CAS DataBase Reference | 5434-21-9(CAS DataBase Reference) |
| EPA Substance Registry System | 4-Aminophthalic acid (5434-21-9) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280g-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






