BD1037932
3-Aminophthalic acid hydrochloride , 98% , 6946-22-1
CAS NO.：6946-22-1
Empirical Formula: C8H8ClNO4
Molecular Weight: 217.61
MDL number: MFCD00017644
EINECS: 230-106-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB65.60 | In Stock |
|
| 10g | RMB117.60 | In Stock |
|
| 25g | RMB195.20 | In Stock |
|
| 100g | RMB596.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 182 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Very Slightly) |
| form | Crystalline Powder |
| color | Off-white to yellow-beige |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C8H7NO4.ClH/c9-5-3-1-2-4(7(10)11)6(5)8(12)13;/h1-3H,9H2,(H,10,11)(H,12,13);1H |
| InChIKey | ZBZAVEORKXFUQB-UHFFFAOYSA-N |
| SMILES | C1(C(=O)O)C(N)=CC=CC=1C(=O)O.Cl |
| CAS DataBase Reference | 6946-22-1(CAS DataBase Reference) |
| EPA Substance Registry System | 1,2-Benzenedicarboxylic acid, 3-amino-, hydrochloride (6946-22-1) |
Description and Uses
3-Aminophthalic Acid Hydrochloride is a reactant used in the preparation of local anesthetics.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 24/25 |
| TSCA | Yes |
| HS Code | 29242998 |
