A6163112
3-Nitrophthalic acid , 96% , 603-11-2
Synonym(s):
3-Nitrobenzene-1,2-dicarboxylic acid;3-Nitrophthalic acid
CAS NO.:603-11-2
Empirical Formula: C8H5NO6
Molecular Weight: 211.13
MDL number: MFCD00007138
EINECS: 210-030-8
| Pack Size | Price | Stock | Quantity |
| 25g | RMB23.20 | In Stock |
|
| 100G | RMB54.40 | In Stock |
|
| 500G | RMB202.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210 °C (dec.) (lit.) |
| Boiling point: | 350.79°C (rough estimate) |
| Density | 1.6342 (rough estimate) |
| vapor density | 7.3 (vs air) |
| refractive index | 1.5282 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | water: soluble5%, clear to slightly hazy, colorless to faint yellow or tan |
| form | Powder |
| pka | pK1:1.88 (25°C) |
| color | Off-white to light yellow |
| Water Solubility | 20 g/L (25 ºC) |
| Decomposition | 216 °C |
| BRN | 2054269 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C8H5NO6/c10-7(11)4-2-1-3-5(9(14)15)6(4)8(12)13/h1-3H,(H,10,11)(H,12,13) |
| InChIKey | KFIRODWJCYBBHY-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cccc(c1C(O)=O)[N+]([O-])=O |
| CAS DataBase Reference | 603-11-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Nitrophthalic acid(603-11-2) |
| EPA Substance Registry System | 3-Nitrophthalic acid (603-11-2) |
Description and Uses
3-Nitrophthalic Acid is a useful chemical in organic synthesis. It is also an impurity of Apremilast.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-41 |
| Safety Statements | 26-36/39-37/39-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29173980 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |








