A6196012
4-Nitrophthalic acid , 98% , 610-27-5
CAS NO.：610-27-5
Empirical Formula: C8H5NO6
Molecular Weight: 211.13
MDL number: MFCD00007252
EINECS: 210-215-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB38.40 | In Stock |
|
| 100G | RMB103.20 | In Stock |
|
| 500G | RMB383.20 | In Stock |
|
| 2.5kg | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 159-161 °C (lit.) |
| Boiling point: | 350.79°C (rough estimate) |
| Density | 1.6342 (rough estimate) |
| refractive index | 1.5282 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 880g/l |
| pka | pK1:2.11 (25°C) |
| form | Crystalline Powder |
| color | Yellow to beige |
| PH | 1 (10g/l, H2O, 20℃) |
| Odor | Odorless |
| PH Range | 1 |
| Water Solubility | 880 g/l at 20 °C |
| BRN | 1882262 |
| InChI | 1S/C8H5NO6/c10-7(11)5-2-1-4(9(14)15)3-6(5)8(12)13/h1-3H,(H,10,11)(H,12,13) |
| InChIKey | SLBQXWXKPNIVSQ-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc(cc1C(O)=O)[N+]([O-])=O |
| CAS DataBase Reference | 610-27-5(CAS DataBase Reference) |
| EPA Substance Registry System | 1,2-Benzenedicarboxylic acid, 4-nitro- (610-27-5) |
Description and Uses
4-Nitrophthalic Acid is an impurity of Apremilast.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29173980 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
