PRODUCT Properties
| Melting point: | 20°C |
| Boiling point: | 98-100°C 8mm |
| Density | 0,988 g/cm3 |
| refractive index | 1.5290 |
| Flash point: | 98-100°C/8mm |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump to clear liquid |
| color | White or Colorless to Almost white or Almost colorless |
| λmax | 251nm(MeOH)(lit.) |
| BRN | 2240987 |
| InChI | InChI=1S/C10H12O/c1-7-4-8(2)6-10(5-7)9(3)11/h4-6H,1-3H3 |
| InChIKey | BKIHFZLJJUNKMZ-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC(C)=CC(C)=C1)C |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P403+P235-P501a |
| Safety Statements | 24/25 |
| HS Code | 2914390090 |





