A8324212
(+)-Usnic acid from Usnea dasypoga , Analysis standard , 7562-61-0
Synonym(s):
(+)-Usnic acid from Usnea dasypoga;2,6-Diacetyl-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3(2H,9bH)-dione
CAS NO.:7562-61-0
Empirical Formula: C18H16O7
Molecular Weight: 344.32
MDL number: MFCD00016878
EINECS: 231-456-0
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB103.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 201-203 °C(lit.) |
| alpha | 488 º (c=0.4, CHCl3) |
| Boiling point: | 399.43°C (rough estimate) |
| Density | 1.2869 (rough estimate) |
| refractive index | 1.4790 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in Chloroform |
| form | powder to crystal |
| pka | 4.00±0.40(Predicted) |
| color | Light orange to Yellow to Green |
| optical activity | [α]25/D +488°, c = 0.7% in chloroform |
| Water Solubility | Partly soluble in water. Soluble in acetone, ethanol, chloroform and furfural. |
| Merck | 14,9893 |
| BRN | 96698 |
| InChI | 1S/C18H16O7/c1-6-14(22)12(8(3)20)16-13(15(6)23)18(4)10(25-16)5-9(21)11(7(2)19)17(18)24/h5,22-24H,1-4H3/t18-/m1/s1 |
| InChIKey | ICTZCAHDGHPRQR-GOSISDBHSA-N |
| SMILES | C[C@](C1=C(O)C(C)=C(O)C(C(C)=O)=C1O2)(C(C3C(C)=O)=O)C2=CC3=O |
| LogP | 1.270 (est) |
| CAS DataBase Reference | 7562-61-0(CAS DataBase Reference) |
Description and Uses
Usnic Acid acts as an antibacterial and antifungal agent, and are often seen used in cosmetics and facial application chemicals.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | HP5295050 |
| F | 3-10 |
| HazardClass | IRRITANT |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |





