A0743612
4-Aminophenyl α-D-mannopyranoside , 98% , 34213-86-0
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB622.40 | In Stock |
|
| 250MG | RMB2486.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165-166°C |
| Boiling point: | 555.9±50.0 °C(Predicted) |
| Density | 1.517±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | H2O: soluble |
| pka | 12.93±0.70(Predicted) |
| form | Solid |
| color | Off-White to Beige |
| Stability: | Hygroscopic |
| InChI | 1S/C12H17NO6/c13-6-1-3-7(4-2-6)18-12-11(17)10(16)9(15)8(5-14)19-12/h1-4,8-12,14-17H,5,13H2 |
| InChIKey | MIAKOEWBCMPCQR-UHFFFAOYSA-N |
| SMILES | Nc1ccc(OC2OC(CO)C(O)C(O)C2O)cc1 |
Description and Uses
Increases the uptake rate of liposomes.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |






