BD1580032
4-Nitrophenyl a-D-mannopyranoside , 98% , 10357-27-4
Synonym(s):
4-Nitrophenyl a-D-mannopyranoside;4-Nitrophenyl alpha-D-mannopyranoside;pNP-alpha-D-Man;pNPalphaMan
CAS NO.：10357-27-4
Empirical Formula: C12H15NO8
Molecular Weight: 301.25
MDL number: MFCD00066002
EINECS: 233-776-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB280.80 | In Stock |
|
| 1g | RMB702.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 179-181 °C |
| Boiling point: | 582.2±50.0 °C(Predicted) |
| Density | 1.599±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMF: 50 mg/mL, clear, very faintly yellow |
| pka | 12.55±0.70(Predicted) |
| form | Powder |
| color | White to Off-white |
| Water Solubility | Soluble in water at 10mg/ml |
| BRN | 92210 |
| InChI | InChI=1S/C12H15NO8/c14-5-8-9(15)10(16)11(17)12(21-8)20-7-3-1-6(2-4-7)13(18)19/h1-4,8-12,14-17H,5H2/t8-,9-,10+,11+,12?/m1/s1 |
| InChIKey | IFBHRQDFSNCLOZ-IKQSSVLVSA-N |
| SMILES | O1C(OC2=CC=C([N+]([O-])=O)C=C2)[C@@H](O)[C@@H](O)[C@H](O)[C@H]1CO |
| CAS DataBase Reference | 10357-27-4(CAS DataBase Reference) |
Description and Uses
p-Nitrophenyl α-D-Mannopyranoside (cas# 10357-27-4) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P280 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29389090 |
