A0743712
4-Amino-3-iodobenzonitrile , 98% , 33348-34-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB30.40 | In Stock |
|
| 5G | RMB84.00 | In Stock |
|
| 25g | RMB269.60 | In Stock |
|
| 100g | RMB923.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-115 °C (lit.) |
| Boiling point: | 328.3±37.0 °C(Predicted) |
| Density | 1.98±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | -0.34±0.10(Predicted) |
| color | White to Amber |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C7H5IN2/c8-6-3-5(4-9)1-2-7(6)10/h1-3H,10H2 |
| InChIKey | UOWVTQFTEAYDLM-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(N)C(I)=C1 |
Description and Uses
Palladium-catalyzed carbonylation of iodoanilines provides ketoamides in the presence of primary and secondary amines.8
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| HS Code | 2926.90.4801 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






