A0745212
Acetyl chloride-d<sub>3</sub> , (D3,98%) , 19259-90-6
Synonym(s):
Trideuteroacetyl chloride
CAS NO.：19259-90-6
Empirical Formula: C2ClD3O
Molecular Weight: 81.52
MDL number: MFCD00000721
EINECS: 242-925-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB1040.00 | In Stock |
|
| 10G | RMB1716.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -112 °C(lit.) |
| Boiling point: | 52 °C(lit.) |
| Density | 1.146 g/mL at 25 °C |
| vapor density | 2.7 (vs air) |
| vapor pressure | 4.97 psi ( 20 °C) |
| refractive index | n |
| Flash point: | 40 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | liquid |
| color | Colourless to slightly yellowish |
| explosive limit | 19% |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C2H3ClO/c1-2(3)4/h1H3/i1D3 |
| InChIKey | WETWJCDKMRHUPV-FIBGUPNXSA-N |
| SMILES | C(=O)(Cl)C([2H])([2H])[2H] |
| CAS Number Unlabeled | 75-36-5 |
Description and Uses
ACETYL CHLORIDE-D3 is a derivative of acetic acid, a weak acid, used as a reagent in numerous industrial processes.
Safety
| Symbol(GHS) |    GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H302-H314 |
| Precautionary statements | P210-P233-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | F,C |
| Risk Statements | 11-14-34 |
| Safety Statements | 9-16-23-45-26 |
| RIDADR | UN 1717 3/PG 2 |
| WGK Germany | 3 |
| Autoignition Temperature | 1353 °F |
| HS Code | 28459000 |
