A0748112
(R)-2-(Aminomethyl)-1-Boc-pyrrolidine , 98% , 259537-92-3
Synonym(s):
(R)-2-(Aminomethyl)-1-(tert-butoxycarbonyl)pyrrolidine;tert-Butyl (R)-2-(aminomethyl)-1-pyrrolidinecarboxylate
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB42.40 | In Stock |
|
| 1G | RMB137.60 | In Stock |
|
| 5G | RMB450.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 98-110℃/1mm |
| Density | 1.044±0.06 g/cm3(Predicted) |
| refractive index | 1.4680 to 1.4720 |
| storage temp. | 2-8°C |
| form | clear liquid |
| pka | 9.91±0.29(Predicted) |
| color | Colorless to Almost colorless |
| optical activity | [α]/D +47.0±2°, c = 1 in chloroform |
| Water Solubility | Slightly soluble in water. |
| BRN | 8905234 |
| InChI | 1S/C10H20N2O2/c1-10(2,3)14-9(13)12-6-4-5-8(12)7-11/h8H,4-7,11H2,1-3H3/t8-/m1/s1 |
| InChIKey | SOGXYCNKQQJEED-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1CN |
| CAS DataBase Reference | 259537-92-3(CAS DataBase Reference) |
Description and Uses
Reactant in the synthesis of diamino derivatives of [1, 2, 4] triazolo [1, 5-a][1, 3, 5] triazine(potent and selective adenosine A2A receptor antagonists).
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H318-H302-H314 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P405-P501a-P280-P305+P351+P338-P310 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,N,C |
| Risk Statements | 36/37/38-51/53-34-22 |
| Safety Statements | 26-36/37/39-61-45 |
| RIDADR | UN 2735PSN1 8 / PGIII |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29339900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






