BD8578431
(S)-1-Boc-2-(Aminomethyl)pyrrolidine , 97% , 119020-01-8
Synonym(s):
(S)-2-(Aminomethyl)-1-(tert-butoxycarbonyl)pyrrolidine;tert-Butyl (S)-2-(aminomethyl)-1-pyrrolidinecarboxylate
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB33.60 | In Stock |
|
| 1g | RMB84.80 | In Stock |
|
| 5g | RMB291.20 | In Stock |
|
| 10g | RMB476.00 | In Stock |
|
| 25g | RMB1128.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 98-112℃/1mm |
| Density | 1.044±0.06 g/cm3(Predicted) |
| refractive index | 1.4670-1.4710 |
| storage temp. | 2-8°C |
| solubility | Miscible with N-methylpyrrolidinone. |
| form | clear liquid |
| pka | 9.91±0.29(Predicted) |
| color | Colorless to Almost colorless |
| BRN | 8905233 |
| InChI | 1S/C10H20N2O2/c1-10(2,3)14-9(13)12-6-4-5-8(12)7-11/h8H,4-7,11H2,1-3H3/t8-/m0/s1 |
| InChIKey | SOGXYCNKQQJEED-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1CN |
| CAS DataBase Reference | 119020-01-8(CAS DataBase Reference) |
Description and Uses
(S)-2-(Aminomethyl)-1-(tert-butoxycarbonyl)pyrrolidine is an optically active compound primarily used in organic synthesis for preparing small-molecule protein synthesis regulators or molecular glue degraders.
(S)-2-Aminomethyl-1-Boc-pyrrolidine acts as an intermediate in organic synthesis. It is also used as a chiral and heterocyclic building block in synthetic chemistry.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P260-P270-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xi,N,C |
| Risk Statements | 36/37/38-51/53-34-22 |
| Safety Statements | 26-36/37/39-61-45 |
| RIDADR | 3259 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | Ⅲ |
| HS Code | 29339900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








