A0749712
1,3-Adamantanediol , 99% , 5001-18-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB96.80 | In Stock |
|
| 100G | RMB473.60 | In Stock |
|
| 500g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~260 °C |
| Boiling point: | 320.4±10.0 °C(Predicted) |
| Density | 1.368±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 14?+-.0.40(Predicted) |
| form | Solid |
| color | White to Off-White |
| BRN | 7013501 |
| InChI | InChI=1S/C10H16O2/c11-9-2-7-1-8(4-9)5-10(12,3-7)6-9/h7-8,11-12H,1-6H2 |
| InChIKey | MOLCWHCSXCKHAP-UHFFFAOYSA-N |
| SMILES | C12(O)CC3CC(CC(O)(C3)C1)C2 |
| CAS DataBase Reference | 5001-18-3(CAS DataBase Reference) |
Description and Uses
1,3-Adamantanediol is used in the synthesis of novel dimethacrylate as possible dental monomers for dental resin mixtures.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29061990 |
| Storage Class | 11 - Combustible Solids |






