LN-832734
BETAMETHASONE 21-PROPIONATE , 0.95 , 75883-07-7
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 223-226C |
| Boiling point: | 588.7±50.0 °C(Predicted) |
| Density | 1.28±0.1 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), DMSO (Sparingly), Methanol (Slightly) |
| form | Solid |
| pka | 11.97±0.70(Predicted) |
| color | White to Off-White |
| Major Application | pharmaceutical |
| InChIKey | ALINSFFSOAHJII-XGQKBEPLSA-N |
| SMILES | F[C@@]21[C@H]([C@H]4[C@@]([C@@]([C@H](C4)C)(O)C(=O)COC(=O)CC)(C[C@@H]2O)C)CCC3=CC(=O)C=C[C@@]31C |
Description and Uses
Betamethasone 21-Propionate (Clobetasol Propionate EP Impurity K) is a degradation product of Betamethasone. Glucocorticoid.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H361 |
| Precautionary statements | P201-P202-P281-P308+P313-P405-P501 |
| target organs | Liver,Kidney,Endocrine system |
| WGK Germany | WGK 3 |
| HS Code | 2937220000 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Repr. 1B STOT RE 2 |







![(4aS,4bS,5aS,6aS,7R,8S,9aS,9bS)-7-Hydroxy-7-(2-hydroxyacetyl)-4a,6a,8-trimethyl-5a,6,6a,7,8,9,9a,9b,10,11-decahydrocyclopenta[1,2]phenanthro[4,4a-b]oxiren-2(4aH)-one](https://img.chemicalbook.com//CAS/GIF/981-34-0.gif)