A0751612
11-Azido-3,6,9-trioxaundecan-1-amine , 98% , 134179-38-7
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB248.00 | In Stock |
|
| 1G | RMB644.80 | In Stock |
|
| 5G | RMB2872.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 198-202°C |
| Density | 1.10 g/mL at 20 °C(lit.) |
| refractive index | n |
| storage temp. | Amber Vial, Refrigerator, Under Inert Atmosphere |
| solubility | miscible with water, polar organic solvents |
| form | Viscous Liquid |
| color | Yellow to Pale Brown |
| Appearance | colorless to yellowish liquid |
| BRN | 4745506 |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C8H18N4O3/c9-1-3-13-5-7-15-8-6-14-4-2-11-12-10/h1-9H2 |
| InChIKey | FPVCVHVTMPCZTH-UHFFFAOYSA-N |
| SMILES | C(OCCOCCN)COCCN=[N+]=[N-] |
Description and Uses
Amino-PEG3-azide is a bifunctional PEG linker containing an amino group and an azide group. The hydrophilic PEG spacer increases solubility in aqueous media. The amino group is reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. The azide group can react with alkyne, BCN, DBCO via Click Chemistry to yield a stable triazole linkage.
11-Azido-3,6,9-trioxaundecan-1-amine is an azide with polyethylene glycol-like characteristics that can be used to prepare azide-functionalized polymers via click reaction.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,Xi |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2735 8/PG 3 |
| WGK Germany | 3 |
| F | 10-34 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29299090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |





