A0753312
2-Amino-5-fluorophenol , 97% , 53981-24-1
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB28.00 | In Stock |
|
| 5G | RMB72.80 | In Stock |
|
| 25g | RMB317.60 | In Stock |
|
| 100g | RMB1194.40 | In Stock |
|
| 500g | RMB5919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38°C |
| Boiling point: | 246.1±25.0 °C(Predicted) |
| Density | 1.347±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | DMSO, Methanol |
| pka | 8.76±0.10(Predicted) |
| form | Solid |
| color | Dark Beige |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C6H6FNO/c7-4-1-2-5(8)6(9)3-4/h1-3,9H,8H2 |
| InChIKey | IIDUNAVOCYMUFB-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(F)=CC=C1N |
| CAS DataBase Reference | 53981-24-1(CAS DataBase Reference) |
Description and Uses
2-Amino-5-fluorophenol is a fluoroaniline metabolite. 2-Amino-5-fluorophenol is used as organic intermediate. To synthesize the intermediate (2-amino-5-fluorophenol-N, N, O-triacetic acid trimethyl ester) of indicator which used in the determination Mg2+ by NMR, three feasible reactions were experimentally carried out, such as alkaline hydrolysis, catalytic hydrogenation and esterification.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H335 |
| Precautionary statements | P280h-P305+P351+P338-P312 |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 29089990 |
