A0756212
5-Aminopyridine-2-carboxylic acid , 98% , 24242-20-4
Synonym(s):
5-Amino-2-picolinic acid;5-amino-2-pyridinecarboxylic acid
| Pack Size | Price | Stock | Quantity |
| 1G | RMB55.20 | In Stock |
|
| 5G | RMB255.20 | In Stock |
|
| 25g | RMB1239.20 | In Stock |
|
| 100g | RMB7599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 222-223 |
| Boiling point: | 420.8±30.0 °C(Predicted) |
| Density | 1.417±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Acetone, Ethanol, Methanol |
| form | Solid |
| pka | 1.33±0.50(Predicted) |
| color | Off-White to Lght Brown |
| InChI | InChI=1S/C6H6N2O2/c7-4-1-2-5(6(9)10)8-3-4/h1-3H,7H2,(H,9,10) |
| InChIKey | WDJARUKOMOGTHA-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=NC=C(N)C=C1 |
| CAS DataBase Reference | 24242-20-4(CAS DataBase Reference) |
Description and Uses
5-Aminopyridine-2-carboxylic Acid is a useful synthetic intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,T,Xn |
| Risk Statements | 23/24/25-36/37/38-22 |
| Safety Statements | 26-36/37/39-45-37 |
| WGK Germany | 3 |
| TSCA | N |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






