BD7938531
Ethyl 5-amino-1H-pyrazole-3-carboxylate , 97% , 105434-90-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB32.80 | In Stock |
|
| 250mg | RMB52.80 | In Stock |
|
| 1g | RMB108.00 | In Stock |
|
| 5g | RMB328.80 | In Stock |
|
| 10g | RMB611.20 | In Stock |
|
| 25g | RMB1133.60 | In Stock |
|
| 100g | RMB3424.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 391.9±22.0 °C(Predicted) |
| Density | 1.318 |
| storage temp. | 2-8°C(protect from light) |
| pka | 12.32±0.10(Predicted) |
| Appearance | Light yellow to light brown Solid |
| InChI | InChI=1S/C6H9N3O2/c1-2-11-6(10)4-3-5(7)9-8-4/h3H,2H2,1H3,(H3,7,8,9) |
| InChIKey | CPQKGGOPHDHAMN-UHFFFAOYSA-N |
| SMILES | N1C(N)=CC(C(OCC)=O)=N1 |
Description and Uses
Ethyl 5-amino-1H-pyrazole-3-carboxylate was used for the synthetic preparation of 5-N,N-Disubstituted 5-aminopyrazole-3-carboxylic acids, an highly potent agonists of GPR109b.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HazardClass | IRRITANT |
