A0756412
3-Aminophenylacetic acid , 97% , 14338-36-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB77.60 | In Stock |
|
| 5G | RMB317.60 | In Stock |
|
| 25G | RMB1472.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 147-150 °C (lit.) |
| Boiling point: | 349.8±17.0 °C(Predicted) |
| Density | 1.268±0.06 g/cm3(Predicted) |
| storage temp. | glass bottle, -20°C Freezer |
| solubility | DMSO, Methanol, Water |
| pka | 4.08±0.10(Predicted) |
| form | Crystalline Powder |
| color | Off-white to light yellow |
| Stability: | Light Sensitive |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C8H9NO2/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4H,5,9H2,(H,10,11) |
| InChIKey | XUSKZLBLGHBCLD-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=CC(N)=C1 |
| CAS DataBase Reference | 14338-36-4(CAS DataBase Reference) |
| EPA Substance Registry System | 3-Aminophenylacetic acid (14338-36-4) |
Description and Uses
3-Aminophenylacetic acid is a useful synthetic intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





