A0758212
6-Amino-7-deazapurine , 97% , 1500-85-2
Synonym(s):
4-Amino-7H-pyrrolo[2,3-d]pyrimidine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB54.40 | In Stock |
|
| 5G | RMB188.80 | In Stock |
|
| 25g | RMB751.20 | In Stock |
|
| 100g | RMB2228.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 257-262℃ |
| Boiling point: | 318.3±45.0 °C(Predicted) |
| Density | 1.61±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 13.38±0.20(Predicted) |
| form | Solid |
| color | White to pale brown |
| Sensitive | Moisture & Light Sensitive |
| InChI | InChI=1S/C6H6N4/c7-5-4-1-2-8-6(4)10-3-9-5/h1-3H,(H3,7,8,9,10) |
| InChIKey | PEHVGBZKEYRQSX-UHFFFAOYSA-N |
| SMILES | C1=NC(N)=C2C=CNC2=N1 |
| CAS DataBase Reference | 1500-85-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 2 |
| RTECS | UY8850000 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 2933599590 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Toxicity | mouse,LD50,intraperitoneal,300mg/kg (300mg/kg),Gann. Japanese Journal of Cancer Research. Vol. 56, Pg. 219, 1965. |



