A0758912
5-Amino-2,4-dichloropyrimidine , 97% , 5177-27-5
CAS NO.:5177-27-5
Empirical Formula: C4H3Cl2N3
Molecular Weight: 163.99
MDL number: MFCD05662684
EINECS: 664-402-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB35.20 | In Stock |
|
| 1G | RMB57.60 | In Stock |
|
| 5G | RMB180.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 108-112C |
| Boiling point: | 290.7±20.0 °C(Predicted) |
| Density | 1.606±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO, Methanol |
| pka | -1.55±0.29(Predicted) |
| form | Solid |
| color | Brown |
| InChI | InChI=1S/C4H3Cl2N3/c5-3-2(7)1-8-4(6)9-3/h1H,7H2 |
| InChIKey | RINHVELYMZLXIW-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(N)C(Cl)=N1 |
| CAS DataBase Reference | 5177-27-5(CAS DataBase Reference) |
Description and Uses
A pyrimidinamine derivative as Plk1 inhibitors
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H317-H318 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39-24/25 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29335990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Sens. 1 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





