BD9166531
5-Amino-2-chloropyrimidine , 98% , 56621-90-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB31.20 | In Stock |
|
| 1g | RMB59.20 | In Stock |
|
| 5g | RMB289.60 | In Stock |
|
| 25g | RMB1300.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 198-199℃ |
| Boiling point: | 338.8±15.0 °C(Predicted) |
| Density | 1.437±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | -0.08±0.10(Predicted) |
| form | Crystalline Powder or Solid |
| color | Yellow to brown |
| InChI | InChI=1S/C4H4ClN3/c5-4-7-1-3(6)2-8-4/h1-2H,6H2 |
| InChIKey | DZBKIOJXVOECRA-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(N)C=N1 |
Description and Uses
5-Amino-2-chloropyrimidine is an aminopyrimidine derivative, a fibroblast growth factor receptor 4 inhibitor with anticancer activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xn |
| Risk Statements | 22-36-36/37/38 |
| Safety Statements | 26-36/37/39-22 |
| HS Code | 29339900 |
