A0761212
3-Amino-4-iodopyridine , 98% , 105752-11-2
Synonym(s):
4-Iodo-3-pyridinamine
CAS NO.：105752-11-2
Empirical Formula: C5H5IN2
Molecular Weight: 220.01
MDL number: MFCD04971334
EINECS: 678-659-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB239.20 | In Stock |
|
| 5G | RMB1039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 69.2-69.5°C |
| Boiling point: | 327.2±27.0 °C(Predicted) |
| Density | 2.055 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | solid |
| pka | 4.79±0.18(Predicted) |
| Appearance | Light yellow to brown Solid |
| Sensitive | Air & Light Sensitive |
| InChI | InChI=1S/C5H5IN2/c6-4-1-2-8-3-5(4)7/h1-3H,7H2 |
| InChIKey | ZJRSKTXMSIVNAU-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(I)=C1N |
| CAS DataBase Reference | 105752-11-2(CAS DataBase Reference) |
Description and Uses
3-Amino-4-iodopyridine is a heterocyclic derivative and can be used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
