A0762812
2-(5-Amino-2-methylanilino)-4-(3-pyridyl)pyrimidine , 98% , 152460-10-1
CAS NO.：152460-10-1
Empirical Formula: C16H15N5
Molecular Weight: 277.32
MDL number: MFCD09028125
EINECS: 1806241-263-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB76.00 | In Stock |
|
| 100G | RMB224.00 | In Stock |
|
| 500G | RMB853.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 133-1350C |
| Boiling point: | 537.3±60.0 °C(Predicted) |
| Density | 1.266±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.77±0.10(Predicted) |
| color | Yellow to Dark Yellow |
| InChI | InChI=1S/C16H15N5/c1-11-4-5-13(17)9-15(11)21-16-19-8-6-14(20-16)12-3-2-7-18-10-12/h2-10H,17H2,1H3,(H,19,20,21) |
| InChIKey | QGAIPGVQJVGBIA-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(C)C(NC2=NC=CC(C3=CC=CN=C3)=N2)=C1 |
| LogP | 1.68 |
| CAS DataBase Reference | 152460-10-1(CAS DataBase Reference) |
Description and Uses
N-(5-Amino-2-methylphenyl)-4-(3-pyridyl)-2-pyrimidineamine (Imatinib EP Impurity F) is a selective inhibitor of protein kinase C (PKC). It is a COVID19-related research product.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| HS Code | 29335990 |
