A4067112
2-(3-Ethoxy-4-ethoxycarbonylphenyl)acetic Acid , 98% , 99469-99-5
Synonym(s):
[3-Ethoxy-4-(ethoxycarbonyl)phenyl]acetic acid
CAS NO.：99469-99-5
Empirical Formula: C13H16O5
Molecular Weight: 252.26
MDL number: MFCD08704233
EINECS: 427-630-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB107.20 | In Stock |
|
| 25G | RMB319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78-80°C |
| Boiling point: | 414.8±35.0 °C(Predicted) |
| Density | 1.191 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 3.96±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C13H16O5/c1-3-17-11-7-9(8-12(14)15)5-6-10(11)13(16)18-4-2/h5-7H,3-4,8H2,1-2H3,(H,14,15) |
| InChIKey | OTGSESBEJUHCES-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=C(C(OCC)=O)C(OCC)=C1 |
| CAS DataBase Reference | 99469-99-5(CAS DataBase Reference) |
Description and Uses
Repaglinide intermediate.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 41 |
| Safety Statements | 26-39 |
| RIDADR | UN3261 |
| HazardClass | 8 |
| HS Code | 2918992090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
