Repaglinide , ≥99% , 135062-02-1
Synonym(s):
(S)-(+)-2-Ethoxy-4-[N-[1-(2-piperidinophenyl)-3-methyl-1-butyl]aminocarbonylmethyl]benzoic acid;Novonorm;Prandin;Repaglinide
CAS NO.:135062-02-1
Empirical Formula: C27H36N2O4
Molecular Weight: 452.59
MDL number: MFCD00906179
EINECS: 629-921-1
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB47.20 | In Stock |
|
| 250MG | RMB113.60 | In Stock |
|
| 1g | RMB214.40 | In Stock |
|
| 200mg | RMB608.00 | In Stock |
|
| 5g | RMB828.80 | In Stock |
|
| 25g | RMB3116.00 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 129-130.2 °C |
| alpha | D20 +6.97° (c = 0.975 in methanol); D20 +7.45° (c = 1.06 in methanol) |
| Boiling point: | 672.9±55.0 °C(Predicted) |
| Density | 1.137±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: 34 mg/mL |
| form | solid |
| pka | 4.19±0.10(Predicted) |
| color | white |
| Water Solubility | 89.99mg/L(25 ºC) |
| Merck | 14,8136 |
| InChIKey | FAEKWTJYAYMJKF-QHCPKHFHSA-N |
| SMILES | C(O)(=O)C1=CC=C(CC(N[C@H](C2=CC=CC=C2N2CCCCC2)CC(C)C)=O)C=C1OCC |
| CAS DataBase Reference | 135062-02-1(CAS DataBase Reference) |
Description and Uses
Repaglinide was marketed in the US as an orally active hypoglycemic agent in patients with a type Ⅱ diabetes mellitus, to lower blood glucose in synergistic combination with metformin, when hyperglycemia cannot be controlled by diet, exercise or metformin alone. Chiral (S)-repaglinide can be synthesized in several ways, each involving a stereoselective reduction of an imine or enamine group. Repaglinide is a nonsulfonylurea belonging to the meglitinide family, with an insulin-releasing effect mediated by pancreatic betacells, by closing the ATP-sensitive K+ channels that, in turn, increases the cytosolic concentration of Ca++. In several animal models, repaglinide was more efficient than glibenclamide as a dose-dependant promoter of insulin release, but its mechanism of action is probably slightly different. Repaglinide has a rapid onset of action, a short duration of action and a reduced risk of hypoglycemia compared to glyburide.
A KIR6 (KATP) channel blocker
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H361-H362 |
| Precautionary statements | P501-P263-P260-P270-P202-P201-P264-P280-P308+P313-P301+P312+P330-P405 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 2 |
| RTECS | 000000033825 |
| HS Code | 2933399090 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 orally in rats: >1 g/kg (Grell) |








