A0764712
2-Amino-3-nitroanisole , 97% , 16554-45-3
CAS NO.:16554-45-3
Empirical Formula: C7H8N2O3
Molecular Weight: 168.15
MDL number: MFCD01930197
EINECS: 240-617-4
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB35.20 | In Stock |
|
| 1G | RMB74.40 | In Stock |
|
| 5G | RMB204.80 | In Stock |
|
| 25G | RMB751.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 73-78℃ |
| Boiling point: | 322.1±22.0 °C(Predicted) |
| Density | 1.318±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | solid |
| pka | -0.35±0.25(Predicted) |
| color | Light yellow to brown |
| InChI | 1S/C7H8N2O3/c1-12-6-4-2-3-5(7(6)8)9(10)11/h2-4H,8H2,1H3 |
| InChIKey | NDKWDGCTUOOAPF-UHFFFAOYSA-N |
| SMILES | NC1=C([N+]([O-])=O)C=CC=C1OC |
Description and Uses
2-Methoxy-6-nitroaniline is useful for preparing pyrimidine derivatives as FGFR4 inhibitors.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H331-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| RIDADR | 2811 |
| WGK Germany | WGK 3 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 2921420090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |



![5-Nitro-3,4-dihydro-2H-benzo[b][1,4]oxazine](https://img.chemicalbook.com/CAS/GIF/137469-90-0.gif)

