A0768612
3-Amino-4-chloropyridine , 98% , 20511-15-3
CAS NO.：20511-15-3
Empirical Formula: C5H5ClN2
Molecular Weight: 128.56
MDL number: MFCD00235124
EINECS: 640-914-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB41.60 | In Stock |
|
| 5G | RMB149.60 | In Stock |
|
| 25G | RMB538.40 | In Stock |
|
| 100G | RMB1841.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 58-63 °C |
| Boiling point: | 247.6±20.0 °C(Predicted) |
| Density | 1.326±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | soluble in Methanol |
| form | Powder or Crystals |
| pka | 3.77±0.10(Predicted) |
| color | White to yellow |
| BRN | 110187 |
| InChI | InChI=1S/C5H5ClN2/c6-4-1-2-8-3-5(4)7/h1-3H,7H2 |
| InChIKey | GTLFLMZOABSJSV-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(Cl)=C1N |
| CAS DataBase Reference | 20511-15-3(CAS DataBase Reference) |
Description and Uses
3-Amino-4-chloropyridine is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi,T |
| Risk Statements | 20/21/22-36/37/38-41-37/38-25 |
| Safety Statements | 26-36/37/39-45-39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29333990 |
