BD0401032
4,6-Dichloropyridin-3-amine , 97% , 7321-93-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB65.60 | In Stock |
|
| 250mg | RMB86.40 | In Stock |
|
| 1g | RMB226.40 | In Stock |
|
| 5g | RMB941.60 | In Stock |
|
| 10g | RMB1708.00 | In Stock |
|
| 25g | RMB3826.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 80-81 °C(Solv: ligroine (8032-32-4)) |
| Boiling point: | 290.8±35.0 °C(Predicted) |
| Density | 1.497±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | Powder |
| pka | 0.72±0.10(Predicted) |
| color | Pale brown |
| InChI | InChI=1S/C5H4Cl2N2/c6-3-1-5(7)9-2-4(3)8/h1-2H,8H2 |
| InChIKey | FBGVTWONYOCYGA-UHFFFAOYSA-N |
| SMILES | C1=NC(Cl)=CC(Cl)=C1N |
Description and Uses
4,6-Dichloropyridin-3-amine is an organic amine compound used in the synthesis of 2,4,5-Trichloropyridine and its derivatives. It is also used as a pharmaceutical intermediate component in the preparation of aromatic bridging cyclic amide derivatives for hepatitis B virus infection.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| RIDADR | UN2811 |
| HazardClass | 6.1 |
| HS Code | 2933399990 |
