A2405812
4-Chloro-2,6-dimethyl-3-nitropyridine , 98% , 15513-48-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB43.20 | In Stock |
|
| 1G | RMB131.76 | In Stock |
|
| 5G | RMB371.20 | In Stock |
|
| 25G | RMB1479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70-73℃ |
| Boiling point: | 270.3±35.0 °C(Predicted) |
| Density | 1.342±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| pka | 2.60±0.10(Predicted) |
| form | Solid |
| color | Off-white |
| InChI | InChI=1S/C7H7ClN2O2/c1-4-3-6(8)7(10(11)12)5(2)9-4/h3H,1-2H3 |
| InChIKey | PSBGFLWVQDGETK-UHFFFAOYSA-N |
| SMILES | C1(C)=NC(C)=CC(Cl)=C1[N+]([O-])=O |
Description and Uses
2,?4,?6-?Trichloro-?3-?nitropyridine is a reagent in the synthesis of Imigliptin, a DPP-4 inhibitor used in the treatment of type 2 diabetes.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P305+P351+P338 |
| HS Code | 2933399990 |
