A0773212
Aciclovir , ≥99% , 59277-89-3
Synonym(s):
9-[(2-Hydroxyethoxy)methyl]guanine;Acycloguanosine;Acyclovir
CAS NO.:59277-89-3
Empirical Formula: C8H11N5O3
Molecular Weight: 225.2
MDL number: MFCD00057880
EINECS: 261-685-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.80 | In Stock |
|
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB86.40 | In Stock |
|
| 100G | RMB246.40 | In Stock |
|
| 500g | RMB828.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 256-257°C |
| Boiling point: | 366.71°C (rough estimate) |
| Density | 1.3654 (rough estimate) |
| refractive index | 1.8000 (estimate) |
| storage temp. | 2-8°C |
| solubility | H2O: 0.7 mg/mL |
| form | powder |
| pka | pKa 2.27 (Uncertain);9.25 (Uncertain) |
| color | white |
| Water Solubility | Soluble in 1M HCl at 50mg/ml. Soluble in water at 0.7mg/ml. Also soluble in DMSO |
| ε(extinction coefficient) | 11.8 at 256nm at 1mM |
| Merck | 14,146 |
| BCS Class | 4,3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C8H11N5O3/c9-8-11-6-5(7(15)12-8)10-3-13(6)4-16-2-1-14/h3,14H,1-2,4H2,(H3,9,11,12,15) |
| InChIKey | MKUXAQIIEYXACX-UHFFFAOYSA-N |
| SMILES | NC1=Nc2c(ncn2COCCO)C(=O)N1 |
| LogP | -0.617 (est) |
| CAS DataBase Reference | 59277-89-3(CAS DataBase Reference) |
| IARC | 3 (Vol. 76) 2000 |
Description and Uses
As it is evident from the chemical structure, acyclovir looks like a nucleoside analog of guanosine in side chain of which, instead of the traditional cyclic sugar residue a 2-hydroxyethoxymethyl acyclic side chain is present. Acyclovir possesses antiviral activity with respect to types 1 and 2 of herpes simplex, shingles virus, Epstein–Barr virus, and cytomegalovirus.
Inhibits cytomegalovirus replication; induces apoptosis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H320 |
| Precautionary statements | P264-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-40-20/21/22 |
| Safety Statements | 22-24/25-36-26-23 |
| WGK Germany | 2 |
| RTECS | UP0791400 |
| HazardClass | IRRITANT |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 59277-89-3(Hazardous Substances Data) |
| Toxicity | LD50 in mice (mg/kg): >10,000 orally; 1000 i.p. (Schaeffer) |






