A1130312
(2-Acetoxyethoxy)methyl acetate , 97% , 59278-00-1
CAS NO.：59278-00-1
Empirical Formula: C7H12O5
Molecular Weight: 176.17
MDL number: MFCD09031327
EINECS: 261-686-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB47.20 | In Stock |
|
| 25G | RMB187.20 | In Stock |
|
| 100G | RMB549.28 | In Stock |
|
| 500G | RMB1710.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 114-1180C/4Torr |
| Density | 1.1382 g/cm3 |
| refractive index | 1.4210 to 1.4250 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Stability: | Below 40C |
| InChI | InChI=1S/C7H12O5/c1-6(8)11-4-3-10-5-12-7(2)9/h3-5H2,1-2H3 |
| InChIKey | XFEQOLXBMLXKDE-UHFFFAOYSA-N |
| SMILES | C(OC(=O)C)COCOC(C)=O |
| CAS DataBase Reference | 59278-00-1(CAS DataBase Reference) |
Description and Uses
Intermediate for the preparation of Acyclovir-d4.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 29153900 |
