A0782912
Amlodipine besylate , 98% , 111470-99-6
Synonym(s):
(4R, S)-3-Ethyl-5-methyl 2-(2-amino-ethoxy-methyl)-4-(2-chlorophenyl)-1,4-dihydroxy-6-methyl pyridine-3,5-dicarboxylate monobenzene sulphonate;2-[(2-Aminoethoxy)-methyl]-4-(2-chlorophenyl)-1,4-dihydro-6-methyl-3,5- pyridinedicarboxylic acid 3-ethyl 5-methyl ester benzene sulfonate;Amlodipine besylate;Norvasc
CAS NO.：111470-99-6
Empirical Formula: C26H31ClN2O8S
Molecular Weight: 567.051
MDL number: MFCD00887594
EINECS: 1312995-182-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB123.20 | In Stock |
|
| 5G | RMB380.00 | In Stock |
|
| 25G | RMB1613.60 | In Stock |
|
| 100G | RMB5439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 199-201°C |
| storage temp. | 2-8°C |
| solubility | DMSO: 20 mg/mL |
| pka | 8.6 |
| form | solid |
| color | white |
| Water Solubility | Soluble in DMSO (20 mg/mL), water (10 mM), chloroform, ethanol (14 mg/mL), and methanol. |
| Merck | 14,491 |
| BCS Class | 1 (CLogP)
3 (LogP) |
| InChIKey | ZPBWCRDSRKPIDG-UHFFFAOYSA-N |
| SMILES | OS(=O)(=O)c1ccccc1.CCOC(=O)C2=C(COCCN)NC(C)=C(C2c3ccccc3Cl)C(=O)OC |
| CAS DataBase Reference | 111470-99-6(CAS DataBase Reference) |
Description and Uses
Anilodipine besylate is a new, once-daily, dihydropyridine calcium antagonist useful in the treatment of hypertension and angina.
Angiotensin II inhibitor prodrug, antihypertensive
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38-20/21/22 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | US7967700 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
