A0789512
Acarbose Hydrate , ≥98% , 56180-94-0
Synonym(s):
4",6"-Dideoxy-4"-([1S]-[1,4,6/5]-4,5,6-trihydroxy-3-hydroxymethyl-2-yclohexenylamino)-maltotriose;Acarbose
CAS NO.:56180-94-0
Empirical Formula: C25H43NO18
Molecular Weight: 645.61
MDL number: MFCD00869592
EINECS: 260-030-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB64.00 | In Stock |
|
| 1G | RMB125.60 | In Stock |
|
| 5G | RMB469.60 | In Stock |
|
| 10g | RMB847.20 | In Stock |
|
| 25g | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165-170°C |
| alpha | D18 +165° (c = 0.4 in water) |
| Boiling point: | 675.05°C (rough estimate) |
| Density | 1.4278 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | 2-8°C |
| solubility | Very soluble in water, soluble in methanol, practically insoluble in methylene chloride. |
| form | Solid |
| pka | 12.39±0.20(Predicted) |
| color | White to Off-White |
| biological source | bacterial (Actinoplanes) |
| Water Solubility | Soluble in water. |
| Merck | 14,18 |
| Stability: | Hygroscopic |
| InChIKey | XUFXOAAUWZOOIT-JMPDRRIHSA-N |
| SMILES | C[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](O[C@@H]2CO)O[C@H]3[C@H](O)[C@@H](O)[C@H](O)O[C@@H]3CO)[C@H](O)[C@@H](O)[C@@H]1N[C@H]4C=C(CO)[C@@H](O)[C@H](O)[C@H]4O |
| LogP | -7.935 (est) |
| CAS DataBase Reference | 56180-94-0 |
Description and Uses
Acarbose, a complex oligosaccharide isolated from Actinoplanes, is reportedly useful as an adjuvant therapy in diabetes. By inhibiting alpha-glucosidase, acarbose delays carbohydrate metabolism in the gastrointestinal tract and modulates changes in food induced blood sugar levels.
antipsychotic: 5HT antagonist, dopamine antagonist, H1-antihistamine, alpha adrenergic blocker
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 1 |
| RTECS | LZ7153000 |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 56180-94-0(Hazardous Substances Data) |
| Toxicity | LD50 orl-rat: 24 g/kg NIIRDN -,2,1995 |





