A0790812
2-Amidinopyridine hydrochloride , 97% , 51285-26-8
CAS NO.:51285-26-8
Empirical Formula: C6H8ClN3
Molecular Weight: 157.6
MDL number: MFCD00052271
EINECS: 676-441-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB48.24 | In Stock |
|
| 5G | RMB127.20 | In Stock |
|
| 25G | RMB426.40 | In Stock |
|
| 100g | RMB1539.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150-152°C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | crystals |
| color | Off-white |
| Sensitive | Hygroscopic |
| BRN | 3562671 |
| InChI | InChI=1S/C6H7N3.ClH/c7-6(8)5-3-1-2-4-9-5;/h1-4H,(H3,7,8);1H |
| InChIKey | GMHCEDDZKAYPLB-UHFFFAOYSA-N |
| SMILES | C(C1N=CC=CC=1)(N)=N.Cl |
| CAS DataBase Reference | 51285-26-8(CAS DataBase Reference) |
Description and Uses
Pyridine-2-carboximidamide hydrochloride serves as a reactant in the synthesis of 1,4-bis[2,6-bis(2-pyridyl)pyrimidin-4-yl]benzene (L1), reacting with 1,4-bis[3-(pyridine-2-yl)propene-1-one]phenylene in ethanol with potassium hydroxide under reflux[6]. As a monoamidine ligand additive, pyridine-2-carboximidamide hydrochloride is incorporated into perovskite precursor solutions to passivate defect sites in the perovskite film[7].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39-37 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |





