A4636312
D(+)-Glucosamine hydrochloride , ≥99%, used for cell culture , 66-84-2
Synonym(s):
D- (+)-Glucosamine hydrochloride;2-Amino-2-deoxy-D -glucose hydrochloride;Chitosamine hydrochloride;GLH
CAS NO.:66-84-2
Empirical Formula: C6H14ClNO5
Molecular Weight: 215.63
MDL number: MFCD00135831
EINECS: 200-638-1
| Pack Size | Price | Stock | Quantity |
| 100G | RMB191.20 | In Stock |
|
| 500G | RMB679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 190-194 °C (dec.)(lit.) |
| alpha | 72.5 º (c=2, H2O, 5hrs.) |
| refractive index | 72 ° (C=1, H2O) |
| storage temp. | 2-8°C |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| form | crystalline |
| color | White |
| biological source | Aspergillus niger maize fruit |
| Water Solubility | soluble |
| Merck | 14,4458 |
| BRN | 4157370 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. |
| Cosmetics Ingredients Functions | ANTISTATIC HAIR CONDITIONING |
| InChI | InChI=1/C6H13NO5.ClH/c7-3-5(10)4(9)2(1-8)12-6(3)11;/h2-6,8-11H,1,7H2;1H/t2-,3-,4-,5-,6?;/s3 |
| InChIKey | QKPLRMLTKYXDST-LPRXMDNASA-N |
| SMILES | [C@H]1(CO)OC([C@H](N)[C@@H](O)[C@@H]1O)O.Cl |&1:0,5,7,9,r| |
| LogP | -2.375 (est) |
| CAS DataBase Reference | 66-84-2(CAS DataBase Reference) |
| EPA Substance Registry System | D-Glucose, 2-amino-2-deoxy-, hydrochloride (66-84-2) |
Description and Uses
Novel application of D-Glucosamine hydrochloride to prepare medical agent for treating vertigo. Found in chitin, in mucoproteins, and in mucopolysaccharides. Antiarthritic. Recent studies show that its chondroprotective activity is related to its antiapoptic properties.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | F,Xi,Xn |
| Risk Statements | 21-36/38-46-62-63 |
| Safety Statements | 24/25-53-36/37-26-25 |
| WGK Germany | 2 |
| RTECS | LZ6665000 |
| F | 3-10 |
| Hazard Note | Highly Flammable |
| TSCA | Yes |
| HS Code | 29329985 |






