A0801957
1,3-Dichloro-2-propanol-d5 , 98atom%D,97%（CP） , 1173020-20-6
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB799.20 | In Stock |
|
| 50mg | RMB2399.20 | In Stock |
|
| 250mg | RMB7199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -4 °C(lit.) |
| Boiling point: | 174.3 °C(lit.) |
| Density | 1.417 g/mL at 25 °C |
| Flash point: | 85 °C |
| solubility | Chloroform (Slightly), Methanol (Slightly), Water |
| form | Oil |
| color | Colourless |
| InChI | 1S/C3H6Cl2O/c4-1-3(6)2-5/h3,6H,1-2H2/i1D2,2D2,3D |
| InChIKey | DEWLEGDTCGBNGU-UXXIZXEISA-N |
| SMILES | [2H]C([2H])(Cl)C([2H])(O)C([2H])([2H])Cl |
| CAS Number Unlabeled | 96-23-1 |
Description and Uses
A labelled chloropropanol which shows toxic effects.
Safety
| Symbol(GHS) |   GHS08,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H312-H350 |
| Precautionary statements | P280-P302+P352-P312-P322-P363-P501-P264-P270-P301+P310-P321-P330-P405-P501 |
| Hazard Codes | T |
| Risk Statements | 45-21-25 |
| Safety Statements | 53-45 |
| RIDADR | UN 2750 6.1/PG 2 |
| WGK Germany | WGK 3 |
| HS Code | 28459000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Carc. 1B |
