A0802612
2-Amino-4′-methoxyacetophenone hydrochloride , 95% , 3883-94-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB103.20 | In Stock |
|
| 1G | RMB239.20 | In Stock |
|
| 5G | RMB799.20 | In Stock |
|
| 25g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 190-193 °C(lit.) |
| storage temp. | -20°C, sealed storage, away from moisture |
| form | Powder |
| color | White to off-white |
| InChI | InChI=1S/C9H11NO2.ClH/c1-12-8-4-2-7(3-5-8)9(11)6-10;/h2-5H,6,10H2,1H3;1H |
| InChIKey | FZVYWBMMOSHMRS-UHFFFAOYSA-N |
| SMILES | C1(C(=O)CN)C=CC(OC)=CC=1.Cl |
Description and Uses
2-Amino-4′-methoxyacetophenone hydrochloride is an organic building block.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29225090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






