A0803250
Titanium(IV)oxideacetylacetonate , 98% , 14024-64-7
Synonym(s):
Bis(acetylacetonato)titanium(IV) oxide, Bis(2,4-pentanedionato)titanium(IV) oxide;TiO(acac)2;Titanium(IV) oxideacetylacetonate;Titanyl acetylacetonate
CAS NO.：14024-64-7
Empirical Formula: C10H14O5Ti
Molecular Weight: 262.08
MDL number: MFCD00013505
EINECS: 237-861-9
| Pack Size | Price | Stock | Quantity |
| 25g | RMB231.20 | In Stock |
|
| 100g | RMB657.60 | In Stock |
|
| 500g | RMB1967.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200 °C |
| Boiling point: | 159.5°C |
| Density | 1[at 20℃] |
| bulk density | 500kg/m3 |
| vapor pressure | 0.001Pa at 25℃ |
| storage temp. | Store below +30°C. |
| solubility | Benzene[soluble in] |
| form | Powder |
| color | yellow |
| Water Solubility | 6.6 g/L (20 ºC) |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | InChI=1S/2C5H8O2.O.Ti/c2*1-4(6)3-5(2)7;;/h2*3,6H,1-2H3;;/q;;;+2/p-2/b2*4-3-;; |
| InChIKey | ZMTWFOKZRDNMEJ-SUKNRPLKSA-L |
| SMILES | [Ti](=O)(O/C(/C)=C\C(=O)C)O/C(/C)=C\C(=O)C |
| LogP | 1.78 at 20℃ |
| CAS DataBase Reference | 14024-64-7 |
| EPA Substance Registry System | Titanium, oxobis(2,4-pentanedionato-.kappa.O,.kappa.O')- (14024-64-7) |
Description and Uses
Employed as a cross linking agent for cellulose fibers.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335-H351 |
| Precautionary statements | P201-P261-P280-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-40 |
| Safety Statements | 7-22-26-37/39-24/25 |
| WGK Germany | 3 |
| RTECS | XR2330000 |
| TSCA | Yes |
| HS Code | 29141900 |
| Toxicity | LD50 ipr-rat: 650 mg/kg NCIUS* PH 43-64-886,JUL,68 |
