A0803312
Amodiaquin dihydrochloride dihydrate , 97% , 6398-98-7
Synonym(s):
4-([7-Chloro-4-quinolinyl]amino)-2-([diethylamino]methyl)phenol;Amodiaquin dihydrochloride dihydrate
CAS NO.:6398-98-7
Empirical Formula: C20H24Cl3N3O
Molecular Weight: 428.78
MDL number: MFCD00078857
EINECS: 642-210-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB142.40 | In Stock |
|
| 25G | RMB304.80 | In Stock |
|
| 100G | RMB1010.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| RTECS | GO7300100 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in DMSO or methanol |
| form | Solid |
| color | White to Yellow to Orange |
| λmax | 342nm(MeOH)(lit.) |
| Merck | 14,572 |
| Stability: | Hygroscopic |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | InChI=1S/C20H22ClN3O.ClH.H2O/c1-3-24(4-2)13-14-11-16(6-8-20(14)25)23-18-9-10-22-19-12-15(21)5-7-17(18)19;;/h5-12,25H,3-4,13H2,1-2H3,(H,22,23);1H;1H2 |
| InChIKey | AOFIMJMWPZOPAJ-UHFFFAOYSA-N |
| SMILES | N(C1C=CC(O)=C(CN(CC)CC)C=1)C1=CC=NC2=CC(Cl)=CC=C12.Cl.O |
| CAS DataBase Reference | 6398-98-7(CAS DataBase Reference) |
Description and Uses
antimalarial
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 2933492250 |
| Storage Class | 11 - Combustible Solids |




