A0807012
3-Amino-2-cyclohexen-1-one , 98%, (dry weight), may contain up to 5%water , 5220-49-5
CAS NO.：5220-49-5
Empirical Formula: C6H9NO
Molecular Weight: 111.14
MDL number: MFCD00013783
EINECS: 226-014-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB29.60 | In Stock |
|
| 5G | RMB56.80 | In Stock |
|
| 25G | RMB221.60 | In Stock |
|
| 100G | RMB863.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 129-133 °C (lit.) |
| Boiling point: | 212.4±30.0 °C(Predicted) |
| Density | 1.091±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C |
| solubility | Methanol[soluble in] |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 5.65±0.20(Predicted) |
| color | Light yellow to Brown to Dark green |
| BRN | 471354 |
| InChI | InChI=1S/C6H9NO/c7-5-2-1-3-6(8)4-5/h4H,1-3,7H2 |
| InChIKey | ZZMRPOAHZITKBV-UHFFFAOYSA-N |
| SMILES | C1(=O)CCCC(N)=C1 |
| CAS DataBase Reference | 5220-49-5(CAS DataBase Reference) |
Description and Uses
3-Amino-2-cyclohexen-1-one was used in the synthesis of a series of 2-amino-5-oxo-4-phenyl-5,6,7,8-tetrahydroquinoline-3-carbonitriles.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 4.6 |
| Hazard Note | Irritant |
| HS Code | 29223990 |
