A0807412
α-[2-(Methylamino)ethyl]benzyl Alcohol , 97% , 42142-52-9
Synonym(s):
3-(Methylamino)-1-phenylpropan-1-ol
CAS NO.:42142-52-9
Empirical Formula: C10H15NO
Molecular Weight: 165.24
MDL number: MFCD00674078
EINECS: 255-679-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB20.00 | In Stock |
|
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB45.60 | In Stock |
|
| 100G | RMB140.00 | In Stock |
|
| 500g | RMB638.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64 °C |
| Boiling point: | 170 °C / 31mmHg |
| Density | 1.017±0.06 g/cm3(Predicted) |
| vapor pressure | 0.037Pa at 25℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Soluble), Methanol (Slightly) |
| pka | 14.24±0.20(Predicted) |
| form | Solid |
| color | Off-White to Pale Yellow |
| InChI | InChI=1S/C10H15NO/c1-11-8-7-10(12)9-5-3-2-4-6-9/h2-6,10-12H,7-8H2,1H3 |
| InChIKey | XXSDCGNHLFVSET-UHFFFAOYSA-N |
| SMILES | C(C1C=CC=CC=1)(O)CCNC |
| LogP | 0.98 |
| CAS DataBase Reference | 42142-52-9(CAS DataBase Reference) |
Description and Uses
3-Hydroxy-N-methyl-3-phenyl-propylamine is an aromatic amino alcohol used as an initiator in radical addition reactions with tetrahalomethanes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| HS Code | 2922199695 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |

![α-[2-(Methylamino)ethyl]benzyl Alcohol](https://img.chemicalbook.com/CAS/GIF/42142-52-9.gif)



