A0808812
4-Azidobenzoic Acid , ≥96.0%(HPLC) , 6427-66-3
Synonym(s):
9-Azidobenzoic acid solution
CAS NO.:6427-66-3
Empirical Formula: C7H5N3O2
Molecular Weight: 163.13
MDL number: MFCD00013987
EINECS: 229-198-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB224.00 | In Stock |
|
| 25G | RMB983.20 | In Stock |
|
| 100g | RMB3791.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180 °C(Solv: water (7732-18-5)) |
| Flash point: | -33℃ |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light red to Green |
| BRN | 1950876 |
| InChI | 1S/C7H5N3O2/c8-10-9-6-3-1-5(2-4-6)7(11)12/h1-4H,(H,11,12) |
| InChIKey | PQXPAFTXDVNANI-UHFFFAOYSA-N |
| SMILES | OC(C1=CC=C(N=[N+]=[N-])C=C1)=O |
| CAS DataBase Reference | 6427-66-3(CAS DataBase Reference) |
Description and Uses
4-Azidobenzoic acid is an aromatic azide used in copper(I)-catalyzed azide-alkyne cycloaddition reactions.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS08,GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H373-H228-H319 |
| Precautionary statements | P210-P240-P241-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| target organs | Blood |
| Hazard Codes | F,Xn |
| Risk Statements | 5-36/37/38-48/20/21/22-38-11 |
| Safety Statements | 15-26-36/37/39-16 |
| RIDADR | 1479 |
| WGK Germany | 3 |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29299090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 2 Skin Irrit. 2 STOT RE 2 |
| Limited Quantities | 5.0 Kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








