A0809412
2-Amino-4-acetamino anisole , ≥95.0% , 6375-47-9
CAS NO.:6375-47-9
Empirical Formula: C9H12N2O2
Molecular Weight: 180.2
MDL number: MFCD00008676
EINECS: 228-938-8
| Pack Size | Price | Stock | Quantity |
| 25G | RMB61.60 | In Stock |
|
| 100G | RMB161.60 | In Stock |
|
| 500g | RMB505.60 | In Stock |
|
| 1kg | RMB879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 109°C |
| Boiling point: | 313.03°C (rough estimate) |
| Density | 1.1819 (rough estimate) |
| refractive index | 1.5373 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 14.23±0.70(Predicted) |
| color | White to Gray to Brown |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C9H12N2O2/c1-6(12)11-7-3-4-9(13-2)8(10)5-7/h3-5H,10H2,1-2H3,(H,11,12) |
| InChIKey | SJWQCBCAGCEWCV-UHFFFAOYSA-N |
| SMILES | C(NC1=CC=C(OC)C(N)=C1)(=O)C |
| CAS DataBase Reference | 6375-47-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Amino-4-acetamino anisole(6375-47-9) |
| EPA Substance Registry System | Acetamide, N-(3-amino-4-methoxyphenyl)- (6375-47-9) |
Description and Uses
3'-Amino-4'-methoxyacetanilide mainly used as a disperse dye intermediate
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H302-H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362-P264-P270-P301+P312-P330-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 2924297099 |




