A0810512
5-Amino-2-chloro-3-picoline , 97% , 38186-82-2
Synonym(s):
5-Amino-2-chloro-3-picoline;6-Chloro-5-methylpyridin-3-amine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB103.20 | In Stock |
|
| 25G | RMB399.20 | In Stock |
|
| 100g | RMB1335.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90.0 to 94.0 °C |
| Boiling point: | 304.7±37.0 °C(Predicted) |
| Density | 1.260±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystalline |
| pka | 2.06±0.10(Predicted) |
| color | White to Brown |
| InChI | InChI=1S/C6H7ClN2/c1-4-2-5(8)3-9-6(4)7/h2-3H,8H2,1H3 |
| InChIKey | VSBISZPNLZFTPG-UHFFFAOYSA-N |
| SMILES | C1=NC(Cl)=C(C)C=C1N |
| CAS DataBase Reference | 38186-82-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41-36/37/38-20/21/22 |
| Safety Statements | 26-39-36/37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |







