A0811012
2-Amino-5-nitro-2’-chlorobenzophenone , ≥98.0%(GC) , 2011-66-7
Synonym(s):
(2-Amino-5-nitrophenyl)(2-chlorophenyl)methanone;2-Amino-2′-chloro-5-nitrobenzophenone
CAS NO.：2011-66-7
Empirical Formula: C13H9ClN2O3
Molecular Weight: 276.68
MDL number: MFCD00792453
EINECS: 217-929-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB53.60 | In Stock |
|
| 25G | RMB192.80 | In Stock |
|
| 100G | RMB617.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 119-121°C |
| Boiling point: | 505.8±45.0 °C(Predicted) |
| Density | 1.428±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | -3.12±0.36(Predicted) |
| form | Powder |
| color | Pale yellow to yellow |
| Sensitive | Air Sensitive |
| BRN | 2814216 |
| InChI | InChI=1S/C13H9ClN2O3/c14-11-4-2-1-3-9(11)13(17)10-7-8(16(18)19)5-6-12(10)15/h1-7H,15H2 |
| InChIKey | GRDGBWVSVMLKBV-UHFFFAOYSA-N |
| SMILES | C(C1=CC([N+]([O-])=O)=CC=C1N)(C1=CC=CC=C1Cl)=O |
| CAS DataBase Reference | 2011-66-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Methanone, (2-amino-5-nitrophenyl)(2-chlorophenyl)-(2011-66-7) |
Description and Uses
2-Amino-5-nitro-2''-chlorobenzophenone (Clonazepam EP Impurity A) is an impurity of Clonazepam (C587080).
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H315-H319-H341-H335-H340 |
| Precautionary statements | P201-P202-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P308+P313-P405-P501-P261-P305+P351+P338-P501a |
| Hazard Codes | Xi |
| Risk Statements | 46-36/37/38 |
| Safety Statements | 53-26-36/37-60 |
| Hazard Note | Irritant |
| HS Code | 29223990 |
