A2527212
3′-Chloroacetophenone , ≥98% , 99-02-5
CAS NO.：99-02-5
Empirical Formula: C8H7ClO
Molecular Weight: 154.59
MDL number: MFCD00000593
EINECS: 202-721-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB48.80 | In Stock |
|
| 100G | RMB167.20 | In Stock |
|
| 500G | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 227-229 °C(lit.) |
| Density | 1.191 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 221 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| Specific Gravity | 1.191 |
| color | Clear colorless to yellow |
| Sensitive | Lachrymatory |
| BRN | 636318 |
| InChI | InChI=1S/C8H7ClO/c1-6(10)7-3-2-4-8(9)5-7/h2-5H,1H3 |
| InChIKey | UUWJBXKHMMQDED-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=CC(Cl)=C1)C |
| CAS DataBase Reference | 99-02-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetophenone, 3'-chloro-(99-02-5) |
| EPA Substance Registry System | Ethanone, 1-(3-chlorophenyl)- (99-02-5) |
Description and Uses
3’-Chloroacetophenone is usd in the synthesis of GABA-AT inhibitors. Also used in the synthesis of antimycobacterial studies.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-36-20/21/22 |
| Safety Statements | 26-36-37/39-36/37/39-13-7/9 |
| RIDADR | UN 3416 6.1/PG 2 |
| WGK Germany | 3 |
| F | 19 |
| Hazard Note | Harmful/Irritant/Lachrymatory |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29147090 |
| Excepted Quantities | Not Permitted as Excepted Quantity |
