M4557153
4-Acetylphenylβ-D-Glucopyranoside , analyticalstandard,≥98.0% , 530-14-3
Synonym(s):
Piceoside;Salicinerein;Salinigrin;p-Hydroxyacetophenone glucoside;1-[4-(β-D -Glucopyranosyloxy)phenyl]ethan-1-one
CAS NO.：530-14-3
Empirical Formula: C14H18O7
Molecular Weight: 298.29
MDL number: MFCD00016916
EINECS: 208-473-7
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB2899.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 195°C |
| alpha | D23 -88° (c = 1) |
| Boiling point: | 399.71°C (rough estimate) |
| Density | 1.3141 (rough estimate) |
| refractive index | 1.6380 (estimate) |
| storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere |
| solubility | Ethanol (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Solid |
| pka | 12.71±0.70(Predicted) |
| color | White to Pale Yellow |
| BRN | 90049 |
| Stability: | Hygroscopic |
| Major Application | food and beverages |
| InChI | 1S/C14H18O7/c1-7(16)8-2-4-9(5-3-8)20-14-13(19)12(18)11(17)10(6-15)21-14/h2-5,10-15,17-19H,6H2,1H3/t10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | GOZCEKPKECLKNO-RKQHYHRCSA-N |
| SMILES | O[C@@H]1[C@@H](O)[C@H](OC2=CC=C(C(C)=O)C=C2)O[C@H](CO)[C@H]1O |
| LogP | -0.970 (est) |
| CAS DataBase Reference | 530-14-3(CAS DataBase Reference) |
Description and Uses
food and beverages
Safety
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
