A0811112
6-Amino-1-methyluracil , ≥98.0%(HPLC) , 2434-53-9
CAS NO.：2434-53-9
Empirical Formula: C5H7N3O2
Molecular Weight: 141.13
MDL number: MFCD00075366
EINECS: 219-422-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB63.20 | In Stock |
|
| 100G | RMB218.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 300 °C |
| Density | 1.339±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in diluted sodium hydroxide solution. |
| pka | 9.26±0.40(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 127771 |
| InChI | InChI=1S/C5H7N3O2/c1-8-3(6)2-4(9)7-5(8)10/h2H,6H2,1H3,(H,7,9,10) |
| InChIKey | GZLZRPNUDBIQBM-UHFFFAOYSA-N |
| SMILES | C1(=O)N(C)C(N)=CC(=O)N1 |
| CAS DataBase Reference | 2434-53-9(CAS DataBase Reference) |
Description and Uses
6-Amino-1-methyluracil is known to exert inhibitory effects towards DNA repair glycosylase. It is also known to be used as a flame retardant.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 29335990 |
