A0811312
                    ALPHA-(4-FLUOROPHENYLIMINO)-P-CRESOL , 98% , 3382-63-6
CAS NO.:3382-63-6
Empirical Formula: C13H10FNO
Molecular Weight: 215.22
MDL number: MFCD00029739
EINECS: 636-494-5
| Pack Size | Price | Stock | Quantity | 
| 5G | RMB39.20 | In Stock | 
                                                 | 
                                        
| 25G | RMB153.60 | In Stock | 
                                                 | 
                                        
| 100g | RMB575.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 179.0 to 183.0 °C | 
                                    
| Boiling point: | 370.9±27.0 °C(Predicted) | 
                                    
| Density | 1.13±0.1 g/cm3(Predicted) | 
                                    
| storage temp. | Sealed in dry,Room Temperature | 
                                    
| solubility | DMSO (Slightly), Methanol (Slightly) | 
                                    
| form | Solid | 
                                    
| pka | 8.56±0.15(Predicted) | 
                                    
| color | Off-White to Dark Yellow | 
                                    
| InChI | InChI=1S/C13H10FNO/c14-11-3-5-12(6-4-11)15-9-10-1-7-13(16)8-2-10/h1-9,16H | 
                                    
| InChIKey | VNNJGDYPPLXJFF-UHFFFAOYSA-N | 
                                    
| SMILES | C1(O)=CC=C(C=NC2=CC=C(F)C=C2)C=C1 | 
                                    
| CAS DataBase Reference | 3382-63-6(CAS DataBase Reference) | 
                                    
Description and Uses
4-{[(p-Fluorophenyl)imino]methyl}phenol is used in the preparation of benzylacetones which promote anti-fungal activity.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H335-H302-H315-H319 | 
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P | 
| HS Code | 2925.29.9000 | 







